Identity and Structure
| Chemical Name | LAE-32 |
|---|---|
| Catalog Entity Type | Compound |
| Formula | C18H21N3O |
| Molar Mass | 295.386 g·mol−1 |
| CAS | 478-99-9 |
| CAS Numbers and Substance Forms | 478-99-9 |
| Synonyms | LAE32; LAE; LSE; Lysergic acid ethylamide; Lysergic acid monoethylamide; N-Ethyllysergamide; NE-LA; N-Ethylergine; N-Ethyl-LSA; N-Ethyl-6-methyl-9,10-didehydroergoline-8β-carboxamide |
| IUPAC Name | (6aR,9R)-N-ethyl-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide |
| InChI | InChI=1S/C18H21N3O/c1-3-19-18(22)12-7-14-13-5-4-6-15-17(13)11(9-20-15)8-16(14)21(2)10-12/h4-7,9,12,16,20H,3,8,10H2,1-2H3,(H,19,22)/t12-,16-/m1/s1 |
| InChIKey | VEBWTGYUIBTVNR-MLGOLLRUSA-N |
| SMILES | CCNC(=O)[C@H]1CN([C@@H]2CC3=CNC4=CC=CC(=C34)C2=C1)C |
Chemical Identifiers
| PubChem CID | 12304966 |
|---|---|
| ChemSpider ID | 19975296 |
| UNII | 72370WPF0J |
| CompTox DTXSID | DTXSID20963946 |
Clinical Data
| Drug Class | Serotonergic psychedelic; Hallucinogen |
|---|---|
| Routes of Administration | Oral, intramuscular injection, subcutaneous injection |
| ATC Code | None |
Sources and Attribution
| Wikipedia Source URL | https://en.wikipedia.org/?curid=6026273 |
|---|---|
| Wikipedia Retrieval Date | 2026-10-21T20:00:17+00:00 |
Reviews
There are no reviews yet.