Identity and Structure
| Chemical Name | LSZ |
|---|---|
| Catalog Entity Type | Compound |
| Formula | C21H25N3O |
| Molar Mass | 335.451 g·mol−1 |
| CAS | 470666-31-0 470666-32-1 |
| CAS Numbers and Substance Forms | freebase: 470666-31-0 tartrate salt: 470666-32-1 |
| Synonyms | Lysergic acid 2,4-dimethylazetidine; Lysergic acid 2S,4S-dimethylazetidine; LSZ; LA-Azetidide; LSD-Azetidide; LA-SS-Az; SS-LSZ; (S,S)-LSZ; Diazedine; λ; Lambda |
| IUPAC Name | [(6aR,9R)-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-yl]-[(2S,4S)-2,4-dimethylazetidin-1-yl]methanone |
| InChI | InChI=1S/C21H25N3O/c1-12-7-13(2)24(12)21(25)15-8-17-16-5-4-6-18-20(16)14(10-22-18)9-19(17)23(3)11-15/h4-6,8,10,12-13,15,19,22H,7,9,11H2,1-3H3/t12-,13-,15+,19+/m0/s1 |
| InChIKey | DUKNIHFTDAXJON-CTQRGLTFSA-N |
| SMILES | freebase: C[C@H]1C[C@@H](N1C(=O)[C@H]2CN([C@@H]3CC4=CNC5=CC=CC(=C45)C3=C2)C)C |
Chemical Identifiers
| PubChem CID | 71301249 |
|---|---|
| ChemSpider ID | 30773535 |
| DrugBank ID | DB15196 |
| UNII | 8SWJ525W4R |
| CompTox DTXSID | DTXSID201026958 |
Clinical Data
| Drug Class | Non-selective serotonin receptor agonist; Serotonin 5-HT2A receptor agonist; Serotonergic psychedelic; Hallucinogen |
|---|---|
| Routes of Administration | Oral |
Pharmacokinetics
| Duration of Action | 3–11 hours (median 8 hours) |
|---|
Legal Status
| Legal Status (Wikipedia Source Text) | DE: NpSG (Industrial and scientific use only) UK: Class A Illegal in Denmark, France, Sweden, and Switzerland |
|---|
Sources and Attribution
| Wikipedia Source URL | https://en.wikipedia.org/?curid=19909799 |
|---|---|
| Wikipedia Retrieval Date | 2026-10-21T20:02:04+00:00 |
Reviews
There are no reviews yet.