Identity and Structure
| Chemical Name | Methylethyltryptamine |
|---|---|
| Catalog Entity Type | Compound |
| Formula | C13H18N2 |
| Molar Mass | 202.301 g·mol−1 |
| CAS | 5599-69-9 |
| CAS Numbers and Substance Forms | 5599-69-9 |
| Synonyms | MET; N-Methyl-N-ethyltryptamine; N,N-MET |
| IUPAC Name | N-ethyl-2-(1H-indol-3-yl)-N-methylethan-1-amine |
| InChI | InChI=1S/C13H18N2/c1-3-15(2)9-8-11-10-14-13-7-5-4-6-12(11)13/h4-7,10,14H,3,8-9H2,1-2H3 |
| InChIKey | MYEGVMLMDWYPOA-UHFFFAOYSA-N |
| SMILES | c1cccc2c1c(c[nH]2)CCN(CC)C |
Chemical Identifiers
| PubChem CID | 824845 |
|---|---|
| ChemSpider ID | 720502 |
| UNII | 4KX1J1D3RD |
| CompTox DTXSID | DTXSID901024010 |
Clinical Data
| Drug Class | Serotonergic psychedelic; Hallucinogen; Serotonin 5-HT2A and 5-HT2C receptor agonist; Serotonin releasing agent |
|---|---|
| Routes of Administration | Oral; Vaporized/inhaled |
| ATC Code | None |
Pharmacokinetics
| Onset of Action | Unknown |
|---|---|
| Duration of Action | Unknown |
Sources and Attribution
| Wikipedia Source URL | https://en.wikipedia.org/?curid=1012509 |
|---|---|
| Wikipedia Retrieval Date | 2026-10-21T20:04:12+00:00 |
Reviews
There are no reviews yet.