Identity and Structure
| Chemical Name | 4-HO-DiPT |
|---|---|
| Catalog Entity Type | Compound |
| Formula | C16H24N2O |
| Molar Mass | 260.381 g·mol−1 |
| CAS | 132328-45-1 63065-90-7 |
| CAS Numbers and Substance Forms | 132328-45-1 HCl: 63065-90-7 |
| Synonyms | 4-OH-DiPT; 4-Hydroxy-N,N-diisopropyltryptamine; Iprocin |
| IUPAC Name | 3-[2-(diisopropylamino)ethyl]-1H-indol-4-ol |
| InChI | InChI=1S/C16H24N2O/c1-11(2)18(12(3)4)9-8-13-10-17-14-6-5-7-15(19)16(13)14/h5-7,10-12,17,19H,8-9H2,1-4H3 |
| InChIKey | KBRYKXCBGISXQV-UHFFFAOYSA-N |
| SMILES | CC(C)N(CCc1c[nH]c2cccc(O)c12)C(C)C |
Chemical Identifiers
| PubChem CID | 21854225 |
|---|---|
| ChemSpider ID | 10579819 |
| UNII | YG9OUS518B KE76PMQ2P3 |
| CompTox DTXSID | DTXSID50618836 |
| ECHA ID | 100.214.853 |
Clinical Data
| Drug Class | Non-selective serotonin receptor agonist; Serotonin 5-HT2A receptor agonist; Serotonergic psychedelic; Hallucinogen |
|---|---|
| Routes of Administration | Oral |
| ATC Code | None |
Pharmacokinetics
| Onset of Action | 15–20 minutes Luvesilocin: ≤1 hour |
|---|---|
| Elimination Half-life | Luvesilocin (s.c.Tooltip subcutaneous injection): 2.7–4.1 h (as 4-HO-DiPT) |
| Duration of Action | 2–3 hours Luvesilocin (s.c.): 3.6 hours (range ~3–4 hours) |
Legal Status
| Legal Status (Wikipedia Source Text) | DE: NpSG (Industrial and scientific use only) UK: Class A US: Unscheduled |
|---|
Sources and Attribution
| Wikipedia Source URL | https://en.wikipedia.org/?curid=854649 |
|---|---|
| Wikipedia Retrieval Date | 2026-10-21T19:43:15+00:00 |
Reviews
There are no reviews yet.